C29H31N5O3 — CID 123825610
5-[3-(4-methylphenyl)-7-(4-pyrazol-1-ylpiperidine-1-carbonyl)quinoxalin-2-yl]pentanoic acid (PubChem CID 123825610) has the molecular formula C29H31N5O3 and a molecular weight of 497.60 g/mol. Its IUPAC name is 5-[3-(4-methylphenyl)-7-(4-pyrazol-1-ylpiperidine-1-carbonyl)quinoxalin-2-yl]pentanoic acid.
| Compound Name | 5-[3-(4-methylphenyl)-7-(4-pyrazol-1-ylpiperidine-1-carbonyl)quinoxalin-2-yl]pentanoic acid |
|---|---|
| PubChem CID | 123825610 |
| Molecular Formula | C29H31N5O3 |
| Molecular Weight | 497.60 g/mol |
| Exact Mass | 497.24 |
| IUPAC Name | 5-[3-(4-methylphenyl)-7-(4-pyrazol-1-ylpiperidine-1-carbonyl)quinoxalin-2-yl]pentanoic acid |
| SMILES | Cc1ccc(-c2nc3ccc(C(=O)N4CCC(n5cccn5)CC4)cc3nc2CCCCC(=O)O)cc1 |
| InChI | InChI=1S/C29H31N5O3/c1-20-7-9-21(10-8-20)28-25(5-2-3-6-27(35)36)31-26-19-22(11-12-24(26)32-28)29(37)33-17-13-23(14-18-33)34-16-4-15-30-34/h4,7-12,15-16,19,23H,2-3,5-6,13-14,17-18H2,1H3,(H,35,36) |
| InChIKey | ZLVGBGNKXJBJTO-UHFFFAOYSA-N |
| XLogP | 5.08 |
| TPSA | 101.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.60 |
| LogP ≤ 5 | 5.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|