C10H6N2S3 — CID 173428603
5-(1,3-thiazol-2-yl)-4-thiophen-2-yl-1,3-thiazole (PubChem CID 173428603) has the molecular formula C10H6N2S3 and a molecular weight of 250.37 g/mol. Its IUPAC name is 5-(1,3-thiazol-2-yl)-4-thiophen-2-yl-1,3-thiazole.
| Compound Name | 5-(1,3-thiazol-2-yl)-4-thiophen-2-yl-1,3-thiazole |
|---|---|
| PubChem CID | 173428603 |
| Molecular Formula | C10H6N2S3 |
| Molecular Weight | 250.37 g/mol |
| Exact Mass | 249.97 |
| IUPAC Name | 5-(1,3-thiazol-2-yl)-4-thiophen-2-yl-1,3-thiazole |
| SMILES | c1csc(-c2ncsc2-c2nccs2)c1 |
| InChI | InChI=1S/C10H6N2S3/c1-2-7(13-4-1)8-9(15-6-12-8)10-11-3-5-14-10/h1-6H |
| InChIKey | IBQFPNOGMOBRJA-UHFFFAOYSA-N |
| XLogP | 4.00 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.37 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |