C8H10N2S2 — CID 144537709
ethane;2-(1,3-thiazol-5-yl)-1,3-thiazole (PubChem CID 144537709) has the molecular formula C8H10N2S2 and a molecular weight of 198.32 g/mol. Its IUPAC name is ethane;2-(1,3-thiazol-5-yl)-1,3-thiazole.
| Compound Name | ethane;2-(1,3-thiazol-5-yl)-1,3-thiazole |
|---|---|
| PubChem CID | 144537709 |
| Molecular Formula | C8H10N2S2 |
| Molecular Weight | 198.32 g/mol |
| Exact Mass | 198.03 |
| IUPAC Name | ethane;2-(1,3-thiazol-5-yl)-1,3-thiazole |
| SMILES | CC.c1csc(-c2cncs2)n1 |
| InChI | InChI=1S/C6H4N2S2.C2H6/c1-2-9-6(8-1)5-3-7-4-10-5;1-2/h1-4H;1-2H3 |
| InChIKey | VURWDZMOZZHITK-UHFFFAOYSA-N |
| XLogP | 3.29 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 198.32 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |