C9H12N2O2S — CID 90912190
N-methyl-2-(1-thiophen-2-ylethenylamino)oxyacetamide (PubChem CID 90912190) has the molecular formula C9H12N2O2S and a molecular weight of 212.27 g/mol. Its IUPAC name is N-methyl-2-(1-thiophen-2-ylethenylamino)oxyacetamide.
| Compound Name | N-methyl-2-(1-thiophen-2-ylethenylamino)oxyacetamide |
|---|---|
| PubChem CID | 90912190 |
| Molecular Formula | C9H12N2O2S |
| Molecular Weight | 212.27 g/mol |
| Exact Mass | 212.06 |
| IUPAC Name | N-methyl-2-(1-thiophen-2-ylethenylamino)oxyacetamide |
| SMILES | C=C(NOCC(=O)NC)c1cccs1 |
| InChI | InChI=1S/C9H12N2O2S/c1-7(8-4-3-5-14-8)11-13-6-9(12)10-2/h3-5,11H,1,6H2,2H3,(H,10,12) |
| InChIKey | ZXZFKOLUODXYQH-UHFFFAOYSA-N |
| XLogP | 0.99 |
| TPSA | 50.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 212.27 |
| LogP ≤ 5 | 0.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|