C10H13NS — CID 118474921
N-methyl-4-thiophen-2-ylpenta-1,4-dien-2-amine (PubChem CID 118474921) has the molecular formula C10H13NS and a molecular weight of 179.29 g/mol. Its IUPAC name is N-methyl-4-thiophen-2-ylpenta-1,4-dien-2-amine.
| Compound Name | N-methyl-4-thiophen-2-ylpenta-1,4-dien-2-amine |
|---|---|
| PubChem CID | 118474921 |
| Molecular Formula | C10H13NS |
| Molecular Weight | 179.29 g/mol |
| Exact Mass | 179.08 |
| IUPAC Name | N-methyl-4-thiophen-2-ylpenta-1,4-dien-2-amine |
| SMILES | C=C(CC(=C)c1cccs1)NC |
| InChI | InChI=1S/C10H13NS/c1-8(7-9(2)11-3)10-5-4-6-12-10/h4-6,11H,1-2,7H2,3H3 |
| InChIKey | LTPMDWHEYFXJCI-UHFFFAOYSA-N |
| XLogP | 2.88 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 179.29 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |