C11H13NS — CID 118140947
N-methyl-N-prop-2-ynyl-2-thiophen-2-ylprop-2-en-1-amine (PubChem CID 118140947) has the molecular formula C11H13NS and a molecular weight of 191.30 g/mol. Its IUPAC name is N-methyl-N-prop-2-ynyl-2-thiophen-2-ylprop-2-en-1-amine.
| Compound Name | N-methyl-N-prop-2-ynyl-2-thiophen-2-ylprop-2-en-1-amine |
|---|---|
| PubChem CID | 118140947 |
| Molecular Formula | C11H13NS |
| Molecular Weight | 191.30 g/mol |
| Exact Mass | 191.08 |
| IUPAC Name | N-methyl-N-prop-2-ynyl-2-thiophen-2-ylprop-2-en-1-amine |
| SMILES | C#CCN(C)CC(=C)c1cccs1 |
| InChI | InChI=1S/C11H13NS/c1-4-7-12(3)9-10(2)11-6-5-8-13-11/h1,5-6,8H,2,7,9H2,3H3 |
| InChIKey | GPXOXKSGBIOBCA-UHFFFAOYSA-N |
| XLogP | 2.33 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 191.30 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|