C6H9N3O3 — CID 151885959
3-amino-4-ethoxy-1H-pyrazole-5-carboxylic acid (PubChem CID 151885959) has the molecular formula C6H9N3O3 and a molecular weight of 171.16 g/mol. Its IUPAC name is 3-amino-4-ethoxy-1H-pyrazole-5-carboxylic acid.
| Compound Name | 3-amino-4-ethoxy-1H-pyrazole-5-carboxylic acid |
|---|---|
| PubChem CID | 151885959 |
| Molecular Formula | C6H9N3O3 |
| Molecular Weight | 171.16 g/mol |
| Exact Mass | 171.06 |
| IUPAC Name | 3-amino-4-ethoxy-1H-pyrazole-5-carboxylic acid |
| SMILES | CCOc1c(N)n[nH]c1C(=O)O |
| InChI | InChI=1S/C6H9N3O3/c1-2-12-4-3(6(10)11)8-9-5(4)7/h2H2,1H3,(H,10,11)(H3,7,8,9) |
| InChIKey | SPSBTMQKIZNIRQ-UHFFFAOYSA-N |
| XLogP | 0.09 |
| TPSA | 101.23 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 171.16 |
| LogP ≤ 5 | 0.09 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |