C11H9F2NO2S — CID 19384259
2-(4,4-difluorobut-3-enylsulfanyl)-1,3-benzoxazol-6-ol (PubChem CID 19384259) has the molecular formula C11H9F2NO2S and a molecular weight of 257.26 g/mol. Its IUPAC name is 2-(4,4-difluorobut-3-enylsulfanyl)-1,3-benzoxazol-6-ol.
| Compound Name | 2-(4,4-difluorobut-3-enylsulfanyl)-1,3-benzoxazol-6-ol |
|---|---|
| PubChem CID | 19384259 |
| Molecular Formula | C11H9F2NO2S |
| Molecular Weight | 257.26 g/mol |
| Exact Mass | 257.03 |
| IUPAC Name | 2-(4,4-difluorobut-3-enylsulfanyl)-1,3-benzoxazol-6-ol |
| SMILES | Oc1ccc2nc(SCCC=C(F)F)oc2c1 |
| InChI | InChI=1S/C11H9F2NO2S/c12-10(13)2-1-5-17-11-14-8-4-3-7(15)6-9(8)16-11/h2-4,6,15H,1,5H2 |
| InChIKey | OHRVPBCRXJFTMW-UHFFFAOYSA-N |
| XLogP | 3.80 |
| TPSA | 46.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.26 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|