C13H13F2NO3S2 — CID 19384351
2-(4,4-difluorobut-3-enylsulfanyl)-5-ethylsulfonyl-1,3-benzoxazole (PubChem CID 19384351) has the molecular formula C13H13F2NO3S2 and a molecular weight of 333.38 g/mol. Its IUPAC name is 2-(4,4-difluorobut-3-enylsulfanyl)-5-ethylsulfonyl-1,3-benzoxazole.
| Compound Name | 2-(4,4-difluorobut-3-enylsulfanyl)-5-ethylsulfonyl-1,3-benzoxazole |
|---|---|
| PubChem CID | 19384351 |
| Molecular Formula | C13H13F2NO3S2 |
| Molecular Weight | 333.38 g/mol |
| Exact Mass | 333.03 |
| IUPAC Name | 2-(4,4-difluorobut-3-enylsulfanyl)-5-ethylsulfonyl-1,3-benzoxazole |
| SMILES | CCS(=O)(=O)c1ccc2oc(SCCC=C(F)F)nc2c1 |
| InChI | InChI=1S/C13H13F2NO3S2/c1-2-21(17,18)9-5-6-11-10(8-9)16-13(19-11)20-7-3-4-12(14)15/h4-6,8H,2-3,7H2,1H3 |
| InChIKey | HEKKIVDFRDUDQO-UHFFFAOYSA-N |
| XLogP | 3.88 |
| TPSA | 60.17 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.38 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|