C8H5NO3 — CID 82415216
6-hydroxy-1,3-benzoxazole-2-carbaldehyde (PubChem CID 82415216) has the molecular formula C8H5NO3 and a molecular weight of 163.13 g/mol. Its IUPAC name is 6-hydroxy-1,3-benzoxazole-2-carbaldehyde.
| Compound Name | 6-hydroxy-1,3-benzoxazole-2-carbaldehyde |
|---|---|
| PubChem CID | 82415216 |
| Molecular Formula | C8H5NO3 |
| Molecular Weight | 163.13 g/mol |
| Exact Mass | 163.03 |
| IUPAC Name | 6-hydroxy-1,3-benzoxazole-2-carbaldehyde |
| SMILES | O=Cc1nc2ccc(O)cc2o1 |
| InChI | InChI=1S/C8H5NO3/c10-4-8-9-6-2-1-5(11)3-7(6)12-8/h1-4,11H |
| InChIKey | UFXKMQRARWLPPF-UHFFFAOYSA-N |
| XLogP | 1.35 |
| TPSA | 63.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 163.13 |
| LogP ≤ 5 | 1.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|