C17H14N2O3 — CID 135538040
2-[(1E,3E)-4-(4-amino-2-hydroxyphenyl)buta-1,3-dienyl]-1,3-benzoxazol-6-ol (PubChem CID 135538040) has the molecular formula C17H14N2O3 and a molecular weight of 294.31 g/mol. Its IUPAC name is 2-[(1E,3E)-4-(4-amino-2-hydroxyphenyl)buta-1,3-dienyl]-1,3-benzoxazol-6-ol.
| Compound Name | 2-[(1E,3E)-4-(4-amino-2-hydroxyphenyl)buta-1,3-dienyl]-1,3-benzoxazol-6-ol |
|---|---|
| PubChem CID | 135538040 |
| Molecular Formula | C17H14N2O3 |
| Molecular Weight | 294.31 g/mol |
| Exact Mass | 294.10 |
| IUPAC Name | 2-[(1E,3E)-4-(4-amino-2-hydroxyphenyl)buta-1,3-dienyl]-1,3-benzoxazol-6-ol |
| SMILES | Nc1ccc(/C=C/C=C/c2nc3ccc(O)cc3o2)c(O)c1 |
| InChI | InChI=1S/C17H14N2O3/c18-12-6-5-11(15(21)9-12)3-1-2-4-17-19-14-8-7-13(20)10-16(14)22-17/h1-10,20-21H,18H2/b3-1+,4-2+ |
| InChIKey | BFXJQQBCSBBJRD-ZPUQHVIOSA-N |
| XLogP | 3.55 |
| TPSA | 92.51 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.31 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|