C14H10N2O3 — CID 122447531
6-(5-methoxy-3-pyridinyl)-1,3-benzoxazole-2-carbaldehyde (PubChem CID 122447531) has the molecular formula C14H10N2O3 and a molecular weight of 254.25 g/mol. Its IUPAC name is 6-(5-methoxy-3-pyridinyl)-1,3-benzoxazole-2-carbaldehyde.
| Compound Name | 6-(5-methoxy-3-pyridinyl)-1,3-benzoxazole-2-carbaldehyde |
|---|---|
| PubChem CID | 122447531 |
| Molecular Formula | C14H10N2O3 |
| Molecular Weight | 254.25 g/mol |
| Exact Mass | 254.07 |
| IUPAC Name | 6-(5-methoxy-3-pyridinyl)-1,3-benzoxazole-2-carbaldehyde |
| SMILES | COc1cncc(-c2ccc3nc(C=O)oc3c2)c1 |
| InChI | InChI=1S/C14H10N2O3/c1-18-11-4-10(6-15-7-11)9-2-3-12-13(5-9)19-14(8-17)16-12/h2-8H,1H3 |
| InChIKey | DLUAFGRQVMYJNZ-UHFFFAOYSA-N |
| XLogP | 2.71 |
| TPSA | 65.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.25 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|