C14H12N2O3S — CID 122447520
2-methyl-6-(5-methylsulfonyl-3-pyridinyl)-1,3-benzoxazole (PubChem CID 122447520) has the molecular formula C14H12N2O3S and a molecular weight of 288.33 g/mol. Its IUPAC name is 2-methyl-6-(5-methylsulfonyl-3-pyridinyl)-1,3-benzoxazole.
| Compound Name | 2-methyl-6-(5-methylsulfonyl-3-pyridinyl)-1,3-benzoxazole |
|---|---|
| PubChem CID | 122447520 |
| Molecular Formula | C14H12N2O3S |
| Molecular Weight | 288.33 g/mol |
| Exact Mass | 288.06 |
| IUPAC Name | 2-methyl-6-(5-methylsulfonyl-3-pyridinyl)-1,3-benzoxazole |
| SMILES | Cc1nc2ccc(-c3cncc(S(C)(=O)=O)c3)cc2o1 |
| InChI | InChI=1S/C14H12N2O3S/c1-9-16-13-4-3-10(6-14(13)19-9)11-5-12(8-15-7-11)20(2,17)18/h3-8H,1-2H3 |
| InChIKey | WDUHDPHUAAZCPN-UHFFFAOYSA-N |
| XLogP | 2.60 |
| TPSA | 73.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.33 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |