C17H13N3O2 — CID 147844868
6-(5-methoxy-3-pyridinyl)-2-(3H-pyrrol-2-yl)-1,3-benzoxazole (PubChem CID 147844868) has the molecular formula C17H13N3O2 and a molecular weight of 291.31 g/mol. Its IUPAC name is 6-(5-methoxy-3-pyridinyl)-2-(3H-pyrrol-2-yl)-1,3-benzoxazole.
| Compound Name | 6-(5-methoxy-3-pyridinyl)-2-(3H-pyrrol-2-yl)-1,3-benzoxazole |
|---|---|
| PubChem CID | 147844868 |
| Molecular Formula | C17H13N3O2 |
| Molecular Weight | 291.31 g/mol |
| Exact Mass | 291.10 |
| IUPAC Name | 6-(5-methoxy-3-pyridinyl)-2-(3H-pyrrol-2-yl)-1,3-benzoxazole |
| SMILES | COc1cncc(-c2ccc3nc(C4=NC=CC4)oc3c2)c1 |
| InChI | InChI=1S/C17H13N3O2/c1-21-13-7-12(9-18-10-13)11-4-5-14-16(8-11)22-17(20-14)15-3-2-6-19-15/h2,4-10H,3H2,1H3 |
| InChIKey | HTRLMUBQEGBXPF-UHFFFAOYSA-N |
| XLogP | 3.60 |
| TPSA | 60.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.31 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |