C22H19NO3 — CID 23025912
2-[3-(2-methoxyethoxy)phenyl]-6-phenyl-1,3-benzoxazole (PubChem CID 23025912) has the molecular formula C22H19NO3 and a molecular weight of 345.40 g/mol. Its IUPAC name is 2-[3-(2-methoxyethoxy)phenyl]-6-phenyl-1,3-benzoxazole.
| Compound Name | 2-[3-(2-methoxyethoxy)phenyl]-6-phenyl-1,3-benzoxazole |
|---|---|
| PubChem CID | 23025912 |
| Molecular Formula | C22H19NO3 |
| Molecular Weight | 345.40 g/mol |
| Exact Mass | 345.14 |
| IUPAC Name | 2-[3-(2-methoxyethoxy)phenyl]-6-phenyl-1,3-benzoxazole |
| SMILES | COCCOc1cccc(-c2nc3ccc(-c4ccccc4)cc3o2)c1 |
| InChI | InChI=1S/C22H19NO3/c1-24-12-13-25-19-9-5-8-18(14-19)22-23-20-11-10-17(15-21(20)26-22)16-6-3-2-4-7-16/h2-11,14-15H,12-13H2,1H3 |
| InChIKey | WPOPWJDJQRFGIC-UHFFFAOYSA-N |
| XLogP | 5.19 |
| TPSA | 44.49 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.40 |
| LogP ≤ 5 | 5.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|