C26H25NO6 — CID 142699942
(2S)-3-[4-[2-[3-(1,3-benzoxazol-2-yl)phenoxy]ethoxy]phenyl]-2-ethoxypropanoic acid (PubChem CID 142699942) has the molecular formula C26H25NO6 and a molecular weight of 447.49 g/mol. Its IUPAC name is (2S)-3-[4-[2-[3-(1,3-benzoxazol-2-yl)phenoxy]ethoxy]phenyl]-2-ethoxypropanoic acid.
| Compound Name | (2S)-3-[4-[2-[3-(1,3-benzoxazol-2-yl)phenoxy]ethoxy]phenyl]-2-ethoxypropanoic acid |
|---|---|
| PubChem CID | 142699942 |
| Molecular Formula | C26H25NO6 |
| Molecular Weight | 447.49 g/mol |
| Exact Mass | 447.17 |
| IUPAC Name | (2S)-3-[4-[2-[3-(1,3-benzoxazol-2-yl)phenoxy]ethoxy]phenyl]-2-ethoxypropanoic acid |
| SMILES | CCO[C@@H](Cc1ccc(OCCOc2cccc(-c3nc4ccccc4o3)c2)cc1)C(=O)O |
| InChI | InChI=1S/C26H25NO6/c1-2-30-24(26(28)29)16-18-10-12-20(13-11-18)31-14-15-32-21-7-5-6-19(17-21)25-27-22-8-3-4-9-23(22)33-25/h3-13,17,24H,2,14-16H2,1H3,(H,28,29)/t24-/m0/s1 |
| InChIKey | XMSNSIPNEXYQJB-DEOSSOPVSA-N |
| XLogP | 4.98 |
| TPSA | 91.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.49 |
| LogP ≤ 5 | 4.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|