methyl 2-(ethylaminomethyl)-1,3-benzoxazole-5-carboxylate

C12H14N2O3 — CID 83949095

IUPACmethyl 2-(ethylaminomethyl)-1,3-benzoxazole-5-carboxylate
SMILESCCNCc1nc2cc(C(=O)OC)ccc2o1
InChIInChI=1S/C12H14N2O3/c1-3-13-7-11-14-9-6-8(12(15)16-2)4-5-10(9)17-11/h4-6,13H,3,7H2,1-2H3
InChIKeyNZXSQORAYAWUFS-UHFFFAOYSA-N
MW234.25 g/mol
LogP1.72
Rot. Bonds4

About methyl 2-(ethylaminomethyl)-1,3-benzoxazole-5-carboxylate

methyl 2-(ethylaminomethyl)-1,3-benzoxazole-5-carboxylate (PubChem CID 83949095) has the molecular formula C12H14N2O3 and a molecular weight of 234.25 g/mol. Its IUPAC name is methyl 2-(ethylaminomethyl)-1,3-benzoxazole-5-carboxylate.

Molecular Properties

Compound Namemethyl 2-(ethylaminomethyl)-1,3-benzoxazole-5-carboxylate
PubChem CID83949095
Molecular FormulaC12H14N2O3
Molecular Weight234.25 g/mol
Exact Mass234.10
IUPAC Namemethyl 2-(ethylaminomethyl)-1,3-benzoxazole-5-carboxylate
SMILESCCNCc1nc2cc(C(=O)OC)ccc2o1
InChIInChI=1S/C12H14N2O3/c1-3-13-7-11-14-9-6-8(12(15)16-2)4-5-10(9)17-11/h4-6,13H,3,7H2,1-2H3
InChIKeyNZXSQORAYAWUFS-UHFFFAOYSA-N
XLogP1.72
TPSA64.36 Ų
H-Bond Donors1
H-Bond Acceptors5
Rotatable Bonds4
Heavy Atoms17
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500234.25
LogP ≤ 51.72
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 105

Analyze methyl 2-(ethylaminomethyl)-1,3-benzoxazole-5-carboxylate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of methyl 2-(ethylaminomethyl)-1,3-benzoxazole-5-carboxylate?
The IUPAC name of methyl 2-(ethylaminomethyl)-1,3-benzoxazole-5-carboxylate (CID 83949095) is methyl 2-(ethylaminomethyl)-1,3-benzoxazole-5-carboxylate.
What is the SMILES notation for methyl 2-(ethylaminomethyl)-1,3-benzoxazole-5-carboxylate?
The canonical SMILES for methyl 2-(ethylaminomethyl)-1,3-benzoxazole-5-carboxylate is CCNCc1nc2cc(C(=O)OC)ccc2o1.
What is the InChIKey of methyl 2-(ethylaminomethyl)-1,3-benzoxazole-5-carboxylate?
The InChIKey is NZXSQORAYAWUFS-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H14N2O3/c1-3-13-7-11-14-9-6-8(12(15)16-2)4-5-10(9)17-11/h4-6,13H,3,7H2,1-2H3.
What are the key properties of methyl 2-(ethylaminomethyl)-1,3-benzoxazole-5-carboxylate?
methyl 2-(ethylaminomethyl)-1,3-benzoxazole-5-carboxylate has a molecular weight of 234.25 g/mol, XLogP of 1.72, 4 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 2-(ethylaminomethyl)-1,3-benzoxazole-5-carboxylate is sourced from PubChem (CID 83949095), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).