C17H15NO3 — CID 142739912
methyl 2-(2,6-dimethylphenyl)-1,3-benzoxazole-5-carboxylate (PubChem CID 142739912) has the molecular formula C17H15NO3 and a molecular weight of 281.31 g/mol. Its IUPAC name is methyl 2-(2,6-dimethylphenyl)-1,3-benzoxazole-5-carboxylate.
| Compound Name | methyl 2-(2,6-dimethylphenyl)-1,3-benzoxazole-5-carboxylate |
|---|---|
| PubChem CID | 142739912 |
| Molecular Formula | C17H15NO3 |
| Molecular Weight | 281.31 g/mol |
| Exact Mass | 281.11 |
| IUPAC Name | methyl 2-(2,6-dimethylphenyl)-1,3-benzoxazole-5-carboxylate |
| SMILES | COC(=O)c1ccc2oc(-c3c(C)cccc3C)nc2c1 |
| InChI | InChI=1S/C17H15NO3/c1-10-5-4-6-11(2)15(10)16-18-13-9-12(17(19)20-3)7-8-14(13)21-16/h4-9H,1-3H3 |
| InChIKey | YYDZYGKCRVYZQA-UHFFFAOYSA-N |
| XLogP | 3.90 |
| TPSA | 52.33 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.31 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |