C9H7F3N2O2 — CID 118814572
[7-(trifluoromethoxy)-1,3-benzoxazol-2-yl]methanamine (PubChem CID 118814572) has the molecular formula C9H7F3N2O2 and a molecular weight of 232.16 g/mol. Its IUPAC name is [7-(trifluoromethoxy)-1,3-benzoxazol-2-yl]methanamine.
| Compound Name | [7-(trifluoromethoxy)-1,3-benzoxazol-2-yl]methanamine |
|---|---|
| PubChem CID | 118814572 |
| Molecular Formula | C9H7F3N2O2 |
| Molecular Weight | 232.16 g/mol |
| Exact Mass | 232.05 |
| IUPAC Name | [7-(trifluoromethoxy)-1,3-benzoxazol-2-yl]methanamine |
| SMILES | NCc1nc2cccc(OC(F)(F)F)c2o1 |
| InChI | InChI=1S/C9H7F3N2O2/c10-9(11,12)16-6-3-1-2-5-8(6)15-7(4-13)14-5/h1-3H,4,13H2 |
| InChIKey | PDCAYZMSUHIKJF-UHFFFAOYSA-N |
| XLogP | 2.19 |
| TPSA | 61.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.16 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |