C13H13NO6S — CID 18967182
2-[(7-ethoxy-1,3-benzoxazol-2-yl)sulfanyl]butanedioic acid (PubChem CID 18967182) has the molecular formula C13H13NO6S and a molecular weight of 311.32 g/mol. Its IUPAC name is 2-[(7-ethoxy-1,3-benzoxazol-2-yl)sulfanyl]butanedioic acid.
| Compound Name | 2-[(7-ethoxy-1,3-benzoxazol-2-yl)sulfanyl]butanedioic acid |
|---|---|
| PubChem CID | 18967182 |
| Molecular Formula | C13H13NO6S |
| Molecular Weight | 311.32 g/mol |
| Exact Mass | 311.05 |
| IUPAC Name | 2-[(7-ethoxy-1,3-benzoxazol-2-yl)sulfanyl]butanedioic acid |
| SMILES | CCOc1cccc2nc(SC(CC(=O)O)C(=O)O)oc12 |
| InChI | InChI=1S/C13H13NO6S/c1-2-19-8-5-3-4-7-11(8)20-13(14-7)21-9(12(17)18)6-10(15)16/h3-5,9H,2,6H2,1H3,(H,15,16)(H,17,18) |
| InChIKey | TYBMTHQVVXMYAK-UHFFFAOYSA-N |
| XLogP | 2.25 |
| TPSA | 109.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.32 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |