C10H7F2NO3 — CID 118992474
1-[7-(difluoromethoxy)-1,3-benzoxazol-2-yl]ethanone (PubChem CID 118992474) has the molecular formula C10H7F2NO3 and a molecular weight of 227.17 g/mol. Its IUPAC name is 1-[7-(difluoromethoxy)-1,3-benzoxazol-2-yl]ethanone.
| Compound Name | 1-[7-(difluoromethoxy)-1,3-benzoxazol-2-yl]ethanone |
|---|---|
| PubChem CID | 118992474 |
| Molecular Formula | C10H7F2NO3 |
| Molecular Weight | 227.17 g/mol |
| Exact Mass | 227.04 |
| IUPAC Name | 1-[7-(difluoromethoxy)-1,3-benzoxazol-2-yl]ethanone |
| SMILES | CC(=O)c1nc2cccc(OC(F)F)c2o1 |
| InChI | InChI=1S/C10H7F2NO3/c1-5(14)9-13-6-3-2-4-7(8(6)16-9)15-10(11)12/h2-4,10H,1H3 |
| InChIKey | QAEFSQCLWONWCZ-UHFFFAOYSA-N |
| XLogP | 2.63 |
| TPSA | 52.33 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 227.17 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |