C11H10BrNO2 — CID 131465086
2-bromo-1-(2-ethyl-1,3-benzoxazol-7-yl)ethanone (PubChem CID 131465086) has the molecular formula C11H10BrNO2 and a molecular weight of 268.11 g/mol. Its IUPAC name is 2-bromo-1-(2-ethyl-1,3-benzoxazol-7-yl)ethanone.
| Compound Name | 2-bromo-1-(2-ethyl-1,3-benzoxazol-7-yl)ethanone |
|---|---|
| PubChem CID | 131465086 |
| Molecular Formula | C11H10BrNO2 |
| Molecular Weight | 268.11 g/mol |
| Exact Mass | 266.99 |
| IUPAC Name | 2-bromo-1-(2-ethyl-1,3-benzoxazol-7-yl)ethanone |
| SMILES | CCc1nc2cccc(C(=O)CBr)c2o1 |
| InChI | InChI=1S/C11H10BrNO2/c1-2-10-13-8-5-3-4-7(9(14)6-12)11(8)15-10/h3-5H,2,6H2,1H3 |
| InChIKey | RCFZBIMQIYTVIQ-UHFFFAOYSA-N |
| XLogP | 2.97 |
| TPSA | 43.10 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.11 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|