C16H19NO3 — CID 114459427
2-(cycloheptylmethyl)-1,3-benzoxazole-4-carboxylic acid (PubChem CID 114459427) has the molecular formula C16H19NO3 and a molecular weight of 273.33 g/mol. Its IUPAC name is 2-(cycloheptylmethyl)-1,3-benzoxazole-4-carboxylic acid.
| Compound Name | 2-(cycloheptylmethyl)-1,3-benzoxazole-4-carboxylic acid |
|---|---|
| PubChem CID | 114459427 |
| Molecular Formula | C16H19NO3 |
| Molecular Weight | 273.33 g/mol |
| Exact Mass | 273.14 |
| IUPAC Name | 2-(cycloheptylmethyl)-1,3-benzoxazole-4-carboxylic acid |
| SMILES | O=C(O)c1cccc2oc(CC3CCCCCC3)nc12 |
| InChI | InChI=1S/C16H19NO3/c18-16(19)12-8-5-9-13-15(12)17-14(20-13)10-11-6-3-1-2-4-7-11/h5,8-9,11H,1-4,6-7,10H2,(H,18,19) |
| InChIKey | SJYLLUMNIDCAJJ-UHFFFAOYSA-N |
| XLogP | 4.04 |
| TPSA | 63.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.33 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |