C16H18N2O3 — CID 63382261
4-[5-(cyclohexylmethyl)-1,3,4-oxadiazol-2-yl]benzoic acid (PubChem CID 63382261) has the molecular formula C16H18N2O3 and a molecular weight of 286.33 g/mol. Its IUPAC name is 4-[5-(cyclohexylmethyl)-1,3,4-oxadiazol-2-yl]benzoic acid.
| Compound Name | 4-[5-(cyclohexylmethyl)-1,3,4-oxadiazol-2-yl]benzoic acid |
|---|---|
| PubChem CID | 63382261 |
| Molecular Formula | C16H18N2O3 |
| Molecular Weight | 286.33 g/mol |
| Exact Mass | 286.13 |
| IUPAC Name | 4-[5-(cyclohexylmethyl)-1,3,4-oxadiazol-2-yl]benzoic acid |
| SMILES | O=C(O)c1ccc(-c2nnc(CC3CCCCC3)o2)cc1 |
| InChI | InChI=1S/C16H18N2O3/c19-16(20)13-8-6-12(7-9-13)15-18-17-14(21-15)10-11-4-2-1-3-5-11/h6-9,11H,1-5,10H2,(H,19,20) |
| InChIKey | QYQFGAQBRDMFID-UHFFFAOYSA-N |
| XLogP | 3.56 |
| TPSA | 76.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.33 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |