C16H18N2O3 — CID 78760189
(5-phenyl-1,3,4-oxadiazol-2-yl)methyl 2-cyclopentylacetate (PubChem CID 78760189) has the molecular formula C16H18N2O3 and a molecular weight of 286.33 g/mol. Its IUPAC name is (5-phenyl-1,3,4-oxadiazol-2-yl)methyl 2-cyclopentylacetate.
| Compound Name | (5-phenyl-1,3,4-oxadiazol-2-yl)methyl 2-cyclopentylacetate |
|---|---|
| PubChem CID | 78760189 |
| Molecular Formula | C16H18N2O3 |
| Molecular Weight | 286.33 g/mol |
| Exact Mass | 286.13 |
| IUPAC Name | (5-phenyl-1,3,4-oxadiazol-2-yl)methyl 2-cyclopentylacetate |
| SMILES | O=C(CC1CCCC1)OCc1nnc(-c2ccccc2)o1 |
| InChI | InChI=1S/C16H18N2O3/c19-15(10-12-6-4-5-7-12)20-11-14-17-18-16(21-14)13-8-2-1-3-9-13/h1-3,8-9,12H,4-7,10-11H2 |
| InChIKey | FXGBXVVRYPZOPR-UHFFFAOYSA-N |
| XLogP | 3.36 |
| TPSA | 65.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.33 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |