C16H17N3O3S2 — CID 8631807
(5-phenyl-1,3,4-oxadiazol-2-yl)methyl 2-(pyrrolidine-1-carbothioylsulfanyl)acetate (PubChem CID 8631807) has the molecular formula C16H17N3O3S2 and a molecular weight of 363.46 g/mol. Its IUPAC name is (5-phenyl-1,3,4-oxadiazol-2-yl)methyl 2-(pyrrolidine-1-carbothioylsulfanyl)acetate.
| Compound Name | (5-phenyl-1,3,4-oxadiazol-2-yl)methyl 2-(pyrrolidine-1-carbothioylsulfanyl)acetate |
|---|---|
| PubChem CID | 8631807 |
| Molecular Formula | C16H17N3O3S2 |
| Molecular Weight | 363.46 g/mol |
| Exact Mass | 363.07 |
| IUPAC Name | (5-phenyl-1,3,4-oxadiazol-2-yl)methyl 2-(pyrrolidine-1-carbothioylsulfanyl)acetate |
| SMILES | O=C(CSC(=S)N1CCCC1)OCc1nnc(-c2ccccc2)o1 |
| InChI | InChI=1S/C16H17N3O3S2/c20-14(11-24-16(23)19-8-4-5-9-19)21-10-13-17-18-15(22-13)12-6-2-1-3-7-12/h1-3,6-7H,4-5,8-11H2 |
| InChIKey | WFLGJOZOCRFRQZ-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 68.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.46 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|