C9H7NO4 — CID 81346660
2-(hydroxymethyl)-1,3-benzoxazole-4-carboxylic acid (PubChem CID 81346660) has the molecular formula C9H7NO4 and a molecular weight of 193.16 g/mol. Its IUPAC name is 2-(hydroxymethyl)-1,3-benzoxazole-4-carboxylic acid.
| Compound Name | 2-(hydroxymethyl)-1,3-benzoxazole-4-carboxylic acid |
|---|---|
| PubChem CID | 81346660 |
| Molecular Formula | C9H7NO4 |
| Molecular Weight | 193.16 g/mol |
| Exact Mass | 193.04 |
| IUPAC Name | 2-(hydroxymethyl)-1,3-benzoxazole-4-carboxylic acid |
| SMILES | O=C(O)c1cccc2oc(CO)nc12 |
| InChI | InChI=1S/C9H7NO4/c11-4-7-10-8-5(9(12)13)2-1-3-6(8)14-7/h1-3,11H,4H2,(H,12,13) |
| InChIKey | KAFZSAIFTDEUTA-UHFFFAOYSA-N |
| XLogP | 1.02 |
| TPSA | 83.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 193.16 |
| LogP ≤ 5 | 1.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |