2-butan-2-yl-1,3-benzoxazole-4-carboxylic acid

C12H13NO3 — CID 81358885

IUPAC2-butan-2-yl-1,3-benzoxazole-4-carboxylic acid
SMILESCCC(C)c1nc2c(C(=O)O)cccc2o1
InChIInChI=1S/C12H13NO3/c1-3-7(2)11-13-10-8(12(14)15)5-4-6-9(10)16-11/h4-7H,3H2,1-2H3,(H,14,15)
InChIKeyHWIAWAJNPZWOHH-UHFFFAOYSA-N
MW219.24 g/mol
LogP3.04
Rot. Bonds3

About 2-butan-2-yl-1,3-benzoxazole-4-carboxylic acid

2-butan-2-yl-1,3-benzoxazole-4-carboxylic acid (PubChem CID 81358885) has the molecular formula C12H13NO3 and a molecular weight of 219.24 g/mol. Its IUPAC name is 2-butan-2-yl-1,3-benzoxazole-4-carboxylic acid.

Molecular Properties

Compound Name2-butan-2-yl-1,3-benzoxazole-4-carboxylic acid
PubChem CID81358885
Molecular FormulaC12H13NO3
Molecular Weight219.24 g/mol
Exact Mass219.09
IUPAC Name2-butan-2-yl-1,3-benzoxazole-4-carboxylic acid
SMILESCCC(C)c1nc2c(C(=O)O)cccc2o1
InChIInChI=1S/C12H13NO3/c1-3-7(2)11-13-10-8(12(14)15)5-4-6-9(10)16-11/h4-7H,3H2,1-2H3,(H,14,15)
InChIKeyHWIAWAJNPZWOHH-UHFFFAOYSA-N
XLogP3.04
TPSA63.33 Ų
H-Bond Donors1
H-Bond Acceptors3
Rotatable Bonds3
Heavy Atoms16
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500219.24
LogP ≤ 53.04
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 103

Analyze 2-butan-2-yl-1,3-benzoxazole-4-carboxylic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-butan-2-yl-1,3-benzoxazole-4-carboxylic acid?
The IUPAC name of 2-butan-2-yl-1,3-benzoxazole-4-carboxylic acid (CID 81358885) is 2-butan-2-yl-1,3-benzoxazole-4-carboxylic acid.
What is the SMILES notation for 2-butan-2-yl-1,3-benzoxazole-4-carboxylic acid?
The canonical SMILES for 2-butan-2-yl-1,3-benzoxazole-4-carboxylic acid is CCC(C)c1nc2c(C(=O)O)cccc2o1.
What is the InChIKey of 2-butan-2-yl-1,3-benzoxazole-4-carboxylic acid?
The InChIKey is HWIAWAJNPZWOHH-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H13NO3/c1-3-7(2)11-13-10-8(12(14)15)5-4-6-9(10)16-11/h4-7H,3H2,1-2H3,(H,14,15).
What are the key properties of 2-butan-2-yl-1,3-benzoxazole-4-carboxylic acid?
2-butan-2-yl-1,3-benzoxazole-4-carboxylic acid has a molecular weight of 219.24 g/mol, XLogP of 3.04, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-butan-2-yl-1,3-benzoxazole-4-carboxylic acid is sourced from PubChem (CID 81358885), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).