2-(2-methyl-1,3-benzoxazol-7-yl)-2-oxoacetic acid

C10H7NO4 — CID 117293084

IUPAC2-(2-methyl-1,3-benzoxazol-7-yl)-2-oxoacetic acid
SMILESCc1nc2cccc(C(=O)C(=O)O)c2o1
InChIInChI=1S/C10H7NO4/c1-5-11-7-4-2-3-6(9(7)15-5)8(12)10(13)14/h2-4H,1H3,(H,13,14)
InChIKeyBXQACUCHTLYILY-UHFFFAOYSA-N
MW205.17 g/mol
LogP1.40
Rot. Bonds2

About 2-(2-methyl-1,3-benzoxazol-7-yl)-2-oxoacetic acid

2-(2-methyl-1,3-benzoxazol-7-yl)-2-oxoacetic acid (PubChem CID 117293084) has the molecular formula C10H7NO4 and a molecular weight of 205.17 g/mol. Its IUPAC name is 2-(2-methyl-1,3-benzoxazol-7-yl)-2-oxoacetic acid.

Molecular Properties

Compound Name2-(2-methyl-1,3-benzoxazol-7-yl)-2-oxoacetic acid
PubChem CID117293084
Molecular FormulaC10H7NO4
Molecular Weight205.17 g/mol
Exact Mass205.04
IUPAC Name2-(2-methyl-1,3-benzoxazol-7-yl)-2-oxoacetic acid
SMILESCc1nc2cccc(C(=O)C(=O)O)c2o1
InChIInChI=1S/C10H7NO4/c1-5-11-7-4-2-3-6(9(7)15-5)8(12)10(13)14/h2-4H,1H3,(H,13,14)
InChIKeyBXQACUCHTLYILY-UHFFFAOYSA-N
XLogP1.40
TPSA80.40 Ų
H-Bond Donors1
H-Bond Acceptors4
Rotatable Bonds2
Heavy Atoms15
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500205.17
LogP ≤ 51.40
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 104

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'diketo_group', 'substructure': 'N/A'}

Analyze 2-(2-methyl-1,3-benzoxazol-7-yl)-2-oxoacetic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-(2-methyl-1,3-benzoxazol-7-yl)-2-oxoacetic acid?
The IUPAC name of 2-(2-methyl-1,3-benzoxazol-7-yl)-2-oxoacetic acid (CID 117293084) is 2-(2-methyl-1,3-benzoxazol-7-yl)-2-oxoacetic acid.
What is the SMILES notation for 2-(2-methyl-1,3-benzoxazol-7-yl)-2-oxoacetic acid?
The canonical SMILES for 2-(2-methyl-1,3-benzoxazol-7-yl)-2-oxoacetic acid is Cc1nc2cccc(C(=O)C(=O)O)c2o1.
What is the InChIKey of 2-(2-methyl-1,3-benzoxazol-7-yl)-2-oxoacetic acid?
The InChIKey is BXQACUCHTLYILY-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H7NO4/c1-5-11-7-4-2-3-6(9(7)15-5)8(12)10(13)14/h2-4H,1H3,(H,13,14).
What are the key properties of 2-(2-methyl-1,3-benzoxazol-7-yl)-2-oxoacetic acid?
2-(2-methyl-1,3-benzoxazol-7-yl)-2-oxoacetic acid has a molecular weight of 205.17 g/mol, XLogP of 1.40, 2 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(2-methyl-1,3-benzoxazol-7-yl)-2-oxoacetic acid is sourced from PubChem (CID 117293084), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).