C12H11NO4 — CID 117337566
ethyl 2-(2-methyl-1,3-benzoxazol-7-yl)-2-oxoacetate (PubChem CID 117337566) has the molecular formula C12H11NO4 and a molecular weight of 233.22 g/mol. Its IUPAC name is ethyl 2-(2-methyl-1,3-benzoxazol-7-yl)-2-oxoacetate.
| Compound Name | ethyl 2-(2-methyl-1,3-benzoxazol-7-yl)-2-oxoacetate |
|---|---|
| PubChem CID | 117337566 |
| Molecular Formula | C12H11NO4 |
| Molecular Weight | 233.22 g/mol |
| Exact Mass | 233.07 |
| IUPAC Name | ethyl 2-(2-methyl-1,3-benzoxazol-7-yl)-2-oxoacetate |
| SMILES | CCOC(=O)C(=O)c1cccc2nc(C)oc12 |
| InChI | InChI=1S/C12H11NO4/c1-3-16-12(15)10(14)8-5-4-6-9-11(8)17-7(2)13-9/h4-6H,3H2,1-2H3 |
| InChIKey | WJWPXLAGNZKXNS-UHFFFAOYSA-N |
| XLogP | 1.88 |
| TPSA | 69.40 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 233.22 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|