C11H8O5S — CID 117383260
ethyl 2-oxo-2-(2-oxo-1,3-benzoxathiol-7-yl)acetate (PubChem CID 117383260) has the molecular formula C11H8O5S and a molecular weight of 252.25 g/mol. Its IUPAC name is ethyl 2-oxo-2-(2-oxo-1,3-benzoxathiol-7-yl)acetate.
| Compound Name | ethyl 2-oxo-2-(2-oxo-1,3-benzoxathiol-7-yl)acetate |
|---|---|
| PubChem CID | 117383260 |
| Molecular Formula | C11H8O5S |
| Molecular Weight | 252.25 g/mol |
| Exact Mass | 252.01 |
| IUPAC Name | ethyl 2-oxo-2-(2-oxo-1,3-benzoxathiol-7-yl)acetate |
| SMILES | CCOC(=O)C(=O)c1cccc2sc(=O)oc12 |
| InChI | InChI=1S/C11H8O5S/c1-2-15-10(13)8(12)6-4-3-5-7-9(6)16-11(14)17-7/h3-5H,2H2,1H3 |
| InChIKey | MECSEQXEXMKNKD-UHFFFAOYSA-N |
| XLogP | 1.60 |
| TPSA | 73.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.25 |
| LogP ≤ 5 | 1.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|