C11H10N2O4 — CID 117339913
ethyl 2-oxo-2-(2-oxo-1,3-dihydrobenzimidazol-4-yl)acetate (PubChem CID 117339913) has the molecular formula C11H10N2O4 and a molecular weight of 234.21 g/mol. Its IUPAC name is ethyl 2-oxo-2-(2-oxo-1,3-dihydrobenzimidazol-4-yl)acetate.
| Compound Name | ethyl 2-oxo-2-(2-oxo-1,3-dihydrobenzimidazol-4-yl)acetate |
|---|---|
| PubChem CID | 117339913 |
| Molecular Formula | C11H10N2O4 |
| Molecular Weight | 234.21 g/mol |
| Exact Mass | 234.06 |
| IUPAC Name | ethyl 2-oxo-2-(2-oxo-1,3-dihydrobenzimidazol-4-yl)acetate |
| SMILES | CCOC(=O)C(=O)c1cccc2[nH]c(=O)[nH]c12 |
| InChI | InChI=1S/C11H10N2O4/c1-2-17-10(15)9(14)6-4-3-5-7-8(6)13-11(16)12-7/h3-5H,2H2,1H3,(H2,12,13,16) |
| InChIKey | VXVWDKIVSURRGW-UHFFFAOYSA-N |
| XLogP | 0.60 |
| TPSA | 92.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.21 |
| LogP ≤ 5 | 0.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|