C10H9NO4 — CID 170859868
5-(methoxymethyl)-1H-3,1-benzoxazine-2,4-dione (PubChem CID 170859868) has the molecular formula C10H9NO4 and a molecular weight of 207.18 g/mol. Its IUPAC name is 5-(methoxymethyl)-1H-3,1-benzoxazine-2,4-dione.
| Compound Name | 5-(methoxymethyl)-1H-3,1-benzoxazine-2,4-dione |
|---|---|
| PubChem CID | 170859868 |
| Molecular Formula | C10H9NO4 |
| Molecular Weight | 207.18 g/mol |
| Exact Mass | 207.05 |
| IUPAC Name | 5-(methoxymethyl)-1H-3,1-benzoxazine-2,4-dione |
| SMILES | COCc1cccc2[nH]c(=O)oc(=O)c12 |
| InChI | InChI=1S/C10H9NO4/c1-14-5-6-3-2-4-7-8(6)9(12)15-10(13)11-7/h2-4H,5H2,1H3,(H,11,13) |
| InChIKey | SCFIBTRZBLNAQH-UHFFFAOYSA-N |
| XLogP | 0.63 |
| TPSA | 72.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 207.18 |
| LogP ≤ 5 | 0.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |