C14H13NO5 — CID 170796942
ethyl 4-(2,4-dioxo-1H-3,1-benzoxazin-5-yl)but-3-enoate (PubChem CID 170796942) has the molecular formula C14H13NO5 and a molecular weight of 275.26 g/mol. Its IUPAC name is ethyl 4-(2,4-dioxo-1H-3,1-benzoxazin-5-yl)but-3-enoate.
| Compound Name | ethyl 4-(2,4-dioxo-1H-3,1-benzoxazin-5-yl)but-3-enoate |
|---|---|
| PubChem CID | 170796942 |
| Molecular Formula | C14H13NO5 |
| Molecular Weight | 275.26 g/mol |
| Exact Mass | 275.08 |
| IUPAC Name | ethyl 4-(2,4-dioxo-1H-3,1-benzoxazin-5-yl)but-3-enoate |
| SMILES | CCOC(=O)CC=Cc1cccc2[nH]c(=O)oc(=O)c12 |
| InChI | InChI=1S/C14H13NO5/c1-2-19-11(16)8-4-6-9-5-3-7-10-12(9)13(17)20-14(18)15-10/h3-7H,2,8H2,1H3,(H,15,18) |
| InChIKey | SKTNDEGVEHPNTL-UHFFFAOYSA-N |
| XLogP | 1.45 |
| TPSA | 89.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.26 |
| LogP ≤ 5 | 1.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |