C17H20N2O5 — CID 170491275
tert-butyl N-[4-(2,4-dioxo-1H-3,1-benzoxazin-5-yl)but-3-enyl]carbamate (PubChem CID 170491275) has the molecular formula C17H20N2O5 and a molecular weight of 332.36 g/mol. Its IUPAC name is tert-butyl N-[4-(2,4-dioxo-1H-3,1-benzoxazin-5-yl)but-3-enyl]carbamate.
| Compound Name | tert-butyl N-[4-(2,4-dioxo-1H-3,1-benzoxazin-5-yl)but-3-enyl]carbamate |
|---|---|
| PubChem CID | 170491275 |
| Molecular Formula | C17H20N2O5 |
| Molecular Weight | 332.36 g/mol |
| Exact Mass | 332.14 |
| IUPAC Name | tert-butyl N-[4-(2,4-dioxo-1H-3,1-benzoxazin-5-yl)but-3-enyl]carbamate |
| SMILES | CC(C)(C)OC(=O)NCCC=Cc1cccc2[nH]c(=O)oc(=O)c12 |
| InChI | InChI=1S/C17H20N2O5/c1-17(2,3)24-15(21)18-10-5-4-7-11-8-6-9-12-13(11)14(20)23-16(22)19-12/h4,6-9H,5,10H2,1-3H3,(H,18,21)(H,19,22) |
| InChIKey | IDBKRKDZJROTBG-UHFFFAOYSA-N |
| XLogP | 2.41 |
| TPSA | 101.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.36 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|