C8H11N3O5 — CID 171898858
4-(2,4-dioxo-1H-pyrimidin-5-yl)-3,4-dihydroxybutanamide (PubChem CID 171898858) has the molecular formula C8H11N3O5 and a molecular weight of 229.19 g/mol. Its IUPAC name is 4-(2,4-dioxo-1H-pyrimidin-5-yl)-3,4-dihydroxybutanamide.
| Compound Name | 4-(2,4-dioxo-1H-pyrimidin-5-yl)-3,4-dihydroxybutanamide |
|---|---|
| PubChem CID | 171898858 |
| Molecular Formula | C8H11N3O5 |
| Molecular Weight | 229.19 g/mol |
| Exact Mass | 229.07 |
| IUPAC Name | 4-(2,4-dioxo-1H-pyrimidin-5-yl)-3,4-dihydroxybutanamide |
| SMILES | NC(=O)CC(O)C(O)c1c[nH]c(=O)[nH]c1=O |
| InChI | InChI=1S/C8H11N3O5/c9-5(13)1-4(12)6(14)3-2-10-8(16)11-7(3)15/h2,4,6,12,14H,1H2,(H2,9,13)(H2,10,11,15,16) |
| InChIKey | BIDLIALGGVUSGB-UHFFFAOYSA-N |
| XLogP | -2.67 |
| TPSA | 149.27 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 229.19 |
| LogP ≤ 5 | -2.67 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |