C12H16N2O5 — CID 171890933
3-[1,2-dihydroxy-4-(methylamino)butyl]-5-nitrobenzaldehyde (PubChem CID 171890933) has the molecular formula C12H16N2O5 and a molecular weight of 268.27 g/mol. Its IUPAC name is 3-[1,2-dihydroxy-4-(methylamino)butyl]-5-nitrobenzaldehyde.
| Compound Name | 3-[1,2-dihydroxy-4-(methylamino)butyl]-5-nitrobenzaldehyde |
|---|---|
| PubChem CID | 171890933 |
| Molecular Formula | C12H16N2O5 |
| Molecular Weight | 268.27 g/mol |
| Exact Mass | 268.11 |
| IUPAC Name | 3-[1,2-dihydroxy-4-(methylamino)butyl]-5-nitrobenzaldehyde |
| SMILES | CNCCC(O)C(O)c1cc(C=O)cc([N+](=O)[O-])c1 |
| InChI | InChI=1S/C12H16N2O5/c1-13-3-2-11(16)12(17)9-4-8(7-15)5-10(6-9)14(18)19/h4-7,11-13,16-17H,2-3H2,1H3 |
| InChIKey | GMLGBWLUCYDRHG-UHFFFAOYSA-N |
| XLogP | 0.41 |
| TPSA | 112.70 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.27 |
| LogP ≤ 5 | 0.41 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|