C15H17N3O6 — CID 171884066
N-[3,4-dihydroxy-4-(3-nitro-4-oxo-1H-quinolin-6-yl)butyl]acetamide (PubChem CID 171884066) has the molecular formula C15H17N3O6 and a molecular weight of 335.32 g/mol. Its IUPAC name is N-[3,4-dihydroxy-4-(3-nitro-4-oxo-1H-quinolin-6-yl)butyl]acetamide.
| Compound Name | N-[3,4-dihydroxy-4-(3-nitro-4-oxo-1H-quinolin-6-yl)butyl]acetamide |
|---|---|
| PubChem CID | 171884066 |
| Molecular Formula | C15H17N3O6 |
| Molecular Weight | 335.32 g/mol |
| Exact Mass | 335.11 |
| IUPAC Name | N-[3,4-dihydroxy-4-(3-nitro-4-oxo-1H-quinolin-6-yl)butyl]acetamide |
| SMILES | CC(=O)NCCC(O)C(O)c1ccc2[nH]cc([N+](=O)[O-])c(=O)c2c1 |
| InChI | InChI=1S/C15H17N3O6/c1-8(19)16-5-4-13(20)14(21)9-2-3-11-10(6-9)15(22)12(7-17-11)18(23)24/h2-3,6-7,13-14,20-21H,4-5H2,1H3,(H,16,19)(H,17,22) |
| InChIKey | JODMTMVKYJNRIW-UHFFFAOYSA-N |
| XLogP | 0.36 |
| TPSA | 145.56 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.32 |
| LogP ≤ 5 | 0.36 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|