C13H13ClN2O5 — CID 171894817
6-(4-chloro-1,2-dihydroxybutyl)-3-nitro-1H-quinolin-4-one (PubChem CID 171894817) has the molecular formula C13H13ClN2O5 and a molecular weight of 312.71 g/mol. Its IUPAC name is 6-(4-chloro-1,2-dihydroxybutyl)-3-nitro-1H-quinolin-4-one.
| Compound Name | 6-(4-chloro-1,2-dihydroxybutyl)-3-nitro-1H-quinolin-4-one |
|---|---|
| PubChem CID | 171894817 |
| Molecular Formula | C13H13ClN2O5 |
| Molecular Weight | 312.71 g/mol |
| Exact Mass | 312.05 |
| IUPAC Name | 6-(4-chloro-1,2-dihydroxybutyl)-3-nitro-1H-quinolin-4-one |
| SMILES | O=c1c([N+](=O)[O-])c[nH]c2ccc(C(O)C(O)CCCl)cc12 |
| InChI | InChI=1S/C13H13ClN2O5/c14-4-3-11(17)12(18)7-1-2-9-8(5-7)13(19)10(6-15-9)16(20)21/h1-2,5-6,11-12,17-18H,3-4H2,(H,15,19) |
| InChIKey | POTGIZOVSYDZSG-UHFFFAOYSA-N |
| XLogP | 1.46 |
| TPSA | 116.46 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.71 |
| LogP ≤ 5 | 1.46 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|