C12H11N3O6 — CID 171869180
2,3-dihydroxy-3-(3-nitro-4-oxo-1H-quinolin-6-yl)propanamide (PubChem CID 171869180) has the molecular formula C12H11N3O6 and a molecular weight of 293.24 g/mol. Its IUPAC name is 2,3-dihydroxy-3-(3-nitro-4-oxo-1H-quinolin-6-yl)propanamide.
| Compound Name | 2,3-dihydroxy-3-(3-nitro-4-oxo-1H-quinolin-6-yl)propanamide |
|---|---|
| PubChem CID | 171869180 |
| Molecular Formula | C12H11N3O6 |
| Molecular Weight | 293.24 g/mol |
| Exact Mass | 293.06 |
| IUPAC Name | 2,3-dihydroxy-3-(3-nitro-4-oxo-1H-quinolin-6-yl)propanamide |
| SMILES | NC(=O)C(O)C(O)c1ccc2[nH]cc([N+](=O)[O-])c(=O)c2c1 |
| InChI | InChI=1S/C12H11N3O6/c13-12(19)11(18)9(16)5-1-2-7-6(3-5)10(17)8(4-14-7)15(20)21/h1-4,9,11,16,18H,(H2,13,19)(H,14,17) |
| InChIKey | CTMZHFKYFHSYGB-UHFFFAOYSA-N |
| XLogP | -0.68 |
| TPSA | 159.55 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.24 |
| LogP ≤ 5 | -0.68 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|