C11H10N2O6 — CID 171869003
3-(2,4-dioxo-1H-3,1-benzoxazin-6-yl)-2,3-dihydroxypropanamide (PubChem CID 171869003) has the molecular formula C11H10N2O6 and a molecular weight of 266.21 g/mol. Its IUPAC name is 3-(2,4-dioxo-1H-3,1-benzoxazin-6-yl)-2,3-dihydroxypropanamide.
| Compound Name | 3-(2,4-dioxo-1H-3,1-benzoxazin-6-yl)-2,3-dihydroxypropanamide |
|---|---|
| PubChem CID | 171869003 |
| Molecular Formula | C11H10N2O6 |
| Molecular Weight | 266.21 g/mol |
| Exact Mass | 266.05 |
| IUPAC Name | 3-(2,4-dioxo-1H-3,1-benzoxazin-6-yl)-2,3-dihydroxypropanamide |
| SMILES | NC(=O)C(O)C(O)c1ccc2[nH]c(=O)oc(=O)c2c1 |
| InChI | InChI=1S/C11H10N2O6/c12-9(16)8(15)7(14)4-1-2-6-5(3-4)10(17)19-11(18)13-6/h1-3,7-8,14-15H,(H2,12,16)(H,13,18) |
| InChIKey | FZYPOPQHCPOAHU-UHFFFAOYSA-N |
| XLogP | -1.64 |
| TPSA | 146.62 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.21 |
| LogP ≤ 5 | -1.64 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |