C11H8N2O5 — CID 171871070
3-(2,4-dioxo-1H-3,1-benzoxazin-6-yl)-2,3-dihydroxypropanenitrile (PubChem CID 171871070) has the molecular formula C11H8N2O5 and a molecular weight of 248.19 g/mol. Its IUPAC name is 3-(2,4-dioxo-1H-3,1-benzoxazin-6-yl)-2,3-dihydroxypropanenitrile.
| Compound Name | 3-(2,4-dioxo-1H-3,1-benzoxazin-6-yl)-2,3-dihydroxypropanenitrile |
|---|---|
| PubChem CID | 171871070 |
| Molecular Formula | C11H8N2O5 |
| Molecular Weight | 248.19 g/mol |
| Exact Mass | 248.04 |
| IUPAC Name | 3-(2,4-dioxo-1H-3,1-benzoxazin-6-yl)-2,3-dihydroxypropanenitrile |
| SMILES | N#CC(O)C(O)c1ccc2[nH]c(=O)oc(=O)c2c1 |
| InChI | InChI=1S/C11H8N2O5/c12-4-8(14)9(15)5-1-2-7-6(3-5)10(16)18-11(17)13-7/h1-3,8-9,14-15H,(H,13,17) |
| InChIKey | FBRQNJWKIRNKEM-UHFFFAOYSA-N |
| XLogP | -0.60 |
| TPSA | 127.32 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.19 |
| LogP ≤ 5 | -0.60 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cyanohydrins', 'substructure': 'N/A'} |
|---|