C13H13NO7 — CID 171896430
methyl 4-(2,4-dioxo-1H-3,1-benzoxazin-6-yl)-3,4-dihydroxybutanoate (PubChem CID 171896430) has the molecular formula C13H13NO7 and a molecular weight of 295.25 g/mol. Its IUPAC name is methyl 4-(2,4-dioxo-1H-3,1-benzoxazin-6-yl)-3,4-dihydroxybutanoate.
| Compound Name | methyl 4-(2,4-dioxo-1H-3,1-benzoxazin-6-yl)-3,4-dihydroxybutanoate |
|---|---|
| PubChem CID | 171896430 |
| Molecular Formula | C13H13NO7 |
| Molecular Weight | 295.25 g/mol |
| Exact Mass | 295.07 |
| IUPAC Name | methyl 4-(2,4-dioxo-1H-3,1-benzoxazin-6-yl)-3,4-dihydroxybutanoate |
| SMILES | COC(=O)CC(O)C(O)c1ccc2[nH]c(=O)oc(=O)c2c1 |
| InChI | InChI=1S/C13H13NO7/c1-20-10(16)5-9(15)11(17)6-2-3-8-7(4-6)12(18)21-13(19)14-8/h2-4,9,11,15,17H,5H2,1H3,(H,14,19) |
| InChIKey | COAYVIPHKXNCPX-UHFFFAOYSA-N |
| XLogP | -0.56 |
| TPSA | 129.83 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.25 |
| LogP ≤ 5 | -0.56 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |