C14H15NO5 — CID 171896381
methyl 3,4-dihydroxy-4-(4-oxo-1H-quinolin-6-yl)butanoate (PubChem CID 171896381) has the molecular formula C14H15NO5 and a molecular weight of 277.28 g/mol. Its IUPAC name is methyl 3,4-dihydroxy-4-(4-oxo-1H-quinolin-6-yl)butanoate.
| Compound Name | methyl 3,4-dihydroxy-4-(4-oxo-1H-quinolin-6-yl)butanoate |
|---|---|
| PubChem CID | 171896381 |
| Molecular Formula | C14H15NO5 |
| Molecular Weight | 277.28 g/mol |
| Exact Mass | 277.10 |
| IUPAC Name | methyl 3,4-dihydroxy-4-(4-oxo-1H-quinolin-6-yl)butanoate |
| SMILES | COC(=O)CC(O)C(O)c1ccc2[nH]ccc(=O)c2c1 |
| InChI | InChI=1S/C14H15NO5/c1-20-13(18)7-12(17)14(19)8-2-3-10-9(6-8)11(16)4-5-15-10/h2-6,12,14,17,19H,7H2,1H3,(H,15,16) |
| InChIKey | QHKDYWMDBQQXCK-UHFFFAOYSA-N |
| XLogP | 0.49 |
| TPSA | 99.62 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.28 |
| LogP ≤ 5 | 0.49 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |