C12H13NO5S — CID 171895820
methyl 3,4-dihydroxy-4-(2-oxo-3H-1,3-benzothiazol-6-yl)butanoate (PubChem CID 171895820) has the molecular formula C12H13NO5S and a molecular weight of 283.31 g/mol. Its IUPAC name is methyl 3,4-dihydroxy-4-(2-oxo-3H-1,3-benzothiazol-6-yl)butanoate.
| Compound Name | methyl 3,4-dihydroxy-4-(2-oxo-3H-1,3-benzothiazol-6-yl)butanoate |
|---|---|
| PubChem CID | 171895820 |
| Molecular Formula | C12H13NO5S |
| Molecular Weight | 283.31 g/mol |
| Exact Mass | 283.05 |
| IUPAC Name | methyl 3,4-dihydroxy-4-(2-oxo-3H-1,3-benzothiazol-6-yl)butanoate |
| SMILES | COC(=O)CC(O)C(O)c1ccc2[nH]c(=O)sc2c1 |
| InChI | InChI=1S/C12H13NO5S/c1-18-10(15)5-8(14)11(16)6-2-3-7-9(4-6)19-12(17)13-7/h2-4,8,11,14,16H,5H2,1H3,(H,13,17) |
| InChIKey | MPKTUCVQIKTRDD-UHFFFAOYSA-N |
| XLogP | 0.55 |
| TPSA | 99.62 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.31 |
| LogP ≤ 5 | 0.55 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |