C10H10ClNO3S — CID 171862263
6-(3-chloro-1,2-dihydroxypropyl)-3H-1,3-benzothiazol-2-one (PubChem CID 171862263) has the molecular formula C10H10ClNO3S and a molecular weight of 259.71 g/mol. Its IUPAC name is 6-(3-chloro-1,2-dihydroxypropyl)-3H-1,3-benzothiazol-2-one.
| Compound Name | 6-(3-chloro-1,2-dihydroxypropyl)-3H-1,3-benzothiazol-2-one |
|---|---|
| PubChem CID | 171862263 |
| Molecular Formula | C10H10ClNO3S |
| Molecular Weight | 259.71 g/mol |
| Exact Mass | 259.01 |
| IUPAC Name | 6-(3-chloro-1,2-dihydroxypropyl)-3H-1,3-benzothiazol-2-one |
| SMILES | O=c1[nH]c2ccc(C(O)C(O)CCl)cc2s1 |
| InChI | InChI=1S/C10H10ClNO3S/c11-4-7(13)9(14)5-1-2-6-8(3-5)16-10(15)12-6/h1-3,7,9,13-14H,4H2,(H,12,15) |
| InChIKey | OOFWWNQICHRICU-UHFFFAOYSA-N |
| XLogP | 1.22 |
| TPSA | 73.32 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.71 |
| LogP ≤ 5 | 1.22 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|