C9H9ClN2OS — CID 86139812
6-(2-chloroethylamino)-3H-1,3-benzothiazol-2-one (PubChem CID 86139812) has the molecular formula C9H9ClN2OS and a molecular weight of 228.70 g/mol. Its IUPAC name is 6-(2-chloroethylamino)-3H-1,3-benzothiazol-2-one.
| Compound Name | 6-(2-chloroethylamino)-3H-1,3-benzothiazol-2-one |
|---|---|
| PubChem CID | 86139812 |
| Molecular Formula | C9H9ClN2OS |
| Molecular Weight | 228.70 g/mol |
| Exact Mass | 228.01 |
| IUPAC Name | 6-(2-chloroethylamino)-3H-1,3-benzothiazol-2-one |
| SMILES | O=c1[nH]c2ccc(NCCCl)cc2s1 |
| InChI | InChI=1S/C9H9ClN2OS/c10-3-4-11-6-1-2-7-8(5-6)14-9(13)12-7/h1-2,5,11H,3-4H2,(H,12,13) |
| InChIKey | AGNKGKICDPJJNQ-UHFFFAOYSA-N |
| XLogP | 2.24 |
| TPSA | 44.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.70 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|