C12H12ClNO3 — CID 171862826
6-(3-chloro-1,2-dihydroxypropyl)-2H-isoquinolin-3-one (PubChem CID 171862826) has the molecular formula C12H12ClNO3 and a molecular weight of 253.69 g/mol. Its IUPAC name is 6-(3-chloro-1,2-dihydroxypropyl)-2H-isoquinolin-3-one.
| Compound Name | 6-(3-chloro-1,2-dihydroxypropyl)-2H-isoquinolin-3-one |
|---|---|
| PubChem CID | 171862826 |
| Molecular Formula | C12H12ClNO3 |
| Molecular Weight | 253.69 g/mol |
| Exact Mass | 253.05 |
| IUPAC Name | 6-(3-chloro-1,2-dihydroxypropyl)-2H-isoquinolin-3-one |
| SMILES | O=c1cc2cc(C(O)C(O)CCl)ccc2c[nH]1 |
| InChI | InChI=1S/C12H12ClNO3/c13-5-10(15)12(17)7-1-2-8-6-14-11(16)4-9(8)3-7/h1-4,6,10,12,15,17H,5H2,(H,14,16) |
| InChIKey | JSCOOITUTNPBNG-UHFFFAOYSA-N |
| XLogP | 1.16 |
| TPSA | 73.32 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.69 |
| LogP ≤ 5 | 1.16 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|