C11H13ClN2O2 — CID 171862236
3-chloro-1-(1-methylindazol-6-yl)propane-1,2-diol (PubChem CID 171862236) has the molecular formula C11H13ClN2O2 and a molecular weight of 240.69 g/mol. Its IUPAC name is 3-chloro-1-(1-methylindazol-6-yl)propane-1,2-diol.
| Compound Name | 3-chloro-1-(1-methylindazol-6-yl)propane-1,2-diol |
|---|---|
| PubChem CID | 171862236 |
| Molecular Formula | C11H13ClN2O2 |
| Molecular Weight | 240.69 g/mol |
| Exact Mass | 240.07 |
| IUPAC Name | 3-chloro-1-(1-methylindazol-6-yl)propane-1,2-diol |
| SMILES | Cn1ncc2ccc(C(O)C(O)CCl)cc21 |
| InChI | InChI=1S/C11H13ClN2O2/c1-14-9-4-7(11(16)10(15)5-12)2-3-8(9)6-13-14/h2-4,6,10-11,15-16H,5H2,1H3 |
| InChIKey | IGQMYEDLAABBIT-UHFFFAOYSA-N |
| XLogP | 1.21 |
| TPSA | 58.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.69 |
| LogP ≤ 5 | 1.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|