C12H10N2O4 — CID 171871058
5-(2-cyano-1,2-dihydroxyethyl)-1H-indole-2-carboxylic acid (PubChem CID 171871058) has the molecular formula C12H10N2O4 and a molecular weight of 246.22 g/mol. Its IUPAC name is 5-(2-cyano-1,2-dihydroxyethyl)-1H-indole-2-carboxylic acid.
| Compound Name | 5-(2-cyano-1,2-dihydroxyethyl)-1H-indole-2-carboxylic acid |
|---|---|
| PubChem CID | 171871058 |
| Molecular Formula | C12H10N2O4 |
| Molecular Weight | 246.22 g/mol |
| Exact Mass | 246.06 |
| IUPAC Name | 5-(2-cyano-1,2-dihydroxyethyl)-1H-indole-2-carboxylic acid |
| SMILES | N#CC(O)C(O)c1ccc2[nH]c(C(=O)O)cc2c1 |
| InChI | InChI=1S/C12H10N2O4/c13-5-10(15)11(16)6-1-2-8-7(3-6)4-9(14-8)12(17)18/h1-4,10-11,14-16H,(H,17,18) |
| InChIKey | FDMRAYFXLLKBHE-UHFFFAOYSA-N |
| XLogP | 0.78 |
| TPSA | 117.34 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.22 |
| LogP ≤ 5 | 0.78 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'cyanohydrins', 'substructure': 'N/A'} |
|---|